C10H11FN4OS — CID 81182274
3-fluoro-5-[(2-methyl-1,2,4-triazol-3-yl)methylsulfinyl]aniline (PubChem CID 81182274) has the molecular formula C10H11FN4OS and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-fluoro-5-[(2-methyl-1,2,4-triazol-3-yl)methylsulfinyl]aniline.
| Compound Name | 3-fluoro-5-[(2-methyl-1,2,4-triazol-3-yl)methylsulfinyl]aniline |
|---|---|
| PubChem CID | 81182274 |
| Molecular Formula | C10H11FN4OS |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 3-fluoro-5-[(2-methyl-1,2,4-triazol-3-yl)methylsulfinyl]aniline |
| SMILES | Cn1ncnc1CS(=O)c1cc(N)cc(F)c1 |
| InChI | InChI=1S/C10H11FN4OS/c1-15-10(13-6-14-15)5-17(16)9-3-7(11)2-8(12)4-9/h2-4,6H,5,12H2,1H3 |
| InChIKey | LJVTZTVWKIUMEH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|