C15H23N4OS+ — CID 166187929
1-(2-methylcyclohexyl)-3-[(2-pyridin-1-ium-1-ylacetyl)amino]thiourea (PubChem CID 166187929) has the molecular formula C15H23N4OS+ and a molecular weight of 307.44 g/mol. Its IUPAC name is 1-(2-methylcyclohexyl)-3-[(2-pyridin-1-ium-1-ylacetyl)amino]thiourea.
| Compound Name | 1-(2-methylcyclohexyl)-3-[(2-pyridin-1-ium-1-ylacetyl)amino]thiourea |
|---|---|
| PubChem CID | 166187929 |
| Molecular Formula | C15H23N4OS+ |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 1-(2-methylcyclohexyl)-3-[(2-pyridin-1-ium-1-ylacetyl)amino]thiourea |
| SMILES | CC1CCCCC1NC(=S)NNC(=O)C[n+]1ccccc1 |
| InChI | InChI=1S/C15H22N4OS/c1-12-7-3-4-8-13(12)16-15(21)18-17-14(20)11-19-9-5-2-6-10-19/h2,5-6,9-10,12-13H,3-4,7-8,11H2,1H3,(H2-,16,17,18,20,21)/p+1 |
| InChIKey | VHNKOKJBSISAMM-UHFFFAOYSA-O |
| XLogP | 1.05 |
| TPSA | 57.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|