C18H25N5O2S — CID 55501458
1-(2-methylcyclohexyl)-3-[[2-(3-methyl-2-oxobenzimidazol-1-yl)acetyl]amino]thiourea (PubChem CID 55501458) has the molecular formula C18H25N5O2S and a molecular weight of 375.50 g/mol. Its IUPAC name is 1-(2-methylcyclohexyl)-3-[[2-(3-methyl-2-oxobenzimidazol-1-yl)acetyl]amino]thiourea.
| Compound Name | 1-(2-methylcyclohexyl)-3-[[2-(3-methyl-2-oxobenzimidazol-1-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 55501458 |
| Molecular Formula | C18H25N5O2S |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 1-(2-methylcyclohexyl)-3-[[2-(3-methyl-2-oxobenzimidazol-1-yl)acetyl]amino]thiourea |
| SMILES | CC1CCCCC1NC(=S)NNC(=O)Cn1c(=O)n(C)c2ccccc21 |
| InChI | InChI=1S/C18H25N5O2S/c1-12-7-3-4-8-13(12)19-17(26)21-20-16(24)11-23-15-10-6-5-9-14(15)22(2)18(23)25/h5-6,9-10,12-13H,3-4,7-8,11H2,1-2H3,(H,20,24)(H2,19,21,26) |
| InChIKey | KWMNTUHHLLQOTH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|