C22H23N3O3S — CID 17426015
N-cyclopropyl-2-[[2-[furan-2-ylmethyl(thiophen-2-ylmethyl)amino]acetyl]amino]benzamide (PubChem CID 17426015) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is N-cyclopropyl-2-[[2-[furan-2-ylmethyl(thiophen-2-ylmethyl)amino]acetyl]amino]benzamide.
| Compound Name | N-cyclopropyl-2-[[2-[furan-2-ylmethyl(thiophen-2-ylmethyl)amino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 17426015 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-cyclopropyl-2-[[2-[furan-2-ylmethyl(thiophen-2-ylmethyl)amino]acetyl]amino]benzamide |
| SMILES | O=C(CN(Cc1ccco1)Cc1cccs1)Nc1ccccc1C(=O)NC1CC1 |
| InChI | InChI=1S/C22H23N3O3S/c26-21(24-20-8-2-1-7-19(20)22(27)23-16-9-10-16)15-25(13-17-5-3-11-28-17)14-18-6-4-12-29-18/h1-8,11-12,16H,9-10,13-15H2,(H,23,27)(H,24,26) |
| InChIKey | RIYODFWIAJGZII-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |