C28H40N4O3 — CID 55852279
N-(1-adamantylcarbamoyl)-2-[4-(3-phenylpropanoylamino)piperidin-1-yl]propanamide (PubChem CID 55852279) has the molecular formula C28H40N4O3 and a molecular weight of 480.65 g/mol. Its IUPAC name is N-(1-adamantylcarbamoyl)-2-[4-(3-phenylpropanoylamino)piperidin-1-yl]propanamide.
| Compound Name | N-(1-adamantylcarbamoyl)-2-[4-(3-phenylpropanoylamino)piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 55852279 |
| Molecular Formula | C28H40N4O3 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | N-(1-adamantylcarbamoyl)-2-[4-(3-phenylpropanoylamino)piperidin-1-yl]propanamide |
| SMILES | CC(C(=O)NC(=O)NC12CC3CC(CC(C3)C1)C2)N1CCC(NC(=O)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C28H40N4O3/c1-19(26(34)30-27(35)31-28-16-21-13-22(17-28)15-23(14-21)18-28)32-11-9-24(10-12-32)29-25(33)8-7-20-5-3-2-4-6-20/h2-6,19,21-24H,7-18H2,1H3,(H,29,33)(H2,30,31,34,35) |
| InChIKey | PZDJYDODEABUCL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |