C23H33N3O2S — CID 47550076
N-[1-[1-(1-adamantylamino)-1-oxopropan-2-yl]piperidin-4-yl]thiophene-3-carboxamide (PubChem CID 47550076) has the molecular formula C23H33N3O2S and a molecular weight of 415.60 g/mol. Its IUPAC name is N-[1-[1-(1-adamantylamino)-1-oxopropan-2-yl]piperidin-4-yl]thiophene-3-carboxamide.
| Compound Name | N-[1-[1-(1-adamantylamino)-1-oxopropan-2-yl]piperidin-4-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 47550076 |
| Molecular Formula | C23H33N3O2S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N-[1-[1-(1-adamantylamino)-1-oxopropan-2-yl]piperidin-4-yl]thiophene-3-carboxamide |
| SMILES | CC(C(=O)NC12CC3CC(CC(C3)C1)C2)N1CCC(NC(=O)c2ccsc2)CC1 |
| InChI | InChI=1S/C23H33N3O2S/c1-15(21(27)25-23-11-16-8-17(12-23)10-18(9-16)13-23)26-5-2-20(3-6-26)24-22(28)19-4-7-29-14-19/h4,7,14-18,20H,2-3,5-6,8-13H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | UBCLOPUSPMPKIH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |