C22H30N4O2 — CID 51289685
N-[1-[1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl]piperidin-4-yl]benzamide (PubChem CID 51289685) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[1-[1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 51289685 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N-[1-[1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl]piperidin-4-yl]benzamide |
| SMILES | CC(C(=O)NC1(C#N)CCCCC1)N1CCC(NC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H30N4O2/c1-17(20(27)25-22(16-23)12-6-3-7-13-22)26-14-10-19(11-15-26)24-21(28)18-8-4-2-5-9-18/h2,4-5,8-9,17,19H,3,6-7,10-15H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | OGAYCOBKQXJVMN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |