C22H29FN4O2 — CID 42955044
N-[1-[1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl]piperidin-4-yl]-4-fluorobenzamide (PubChem CID 42955044) has the molecular formula C22H29FN4O2 and a molecular weight of 400.50 g/mol. Its IUPAC name is N-[1-[1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl]piperidin-4-yl]-4-fluorobenzamide.
| Compound Name | N-[1-[1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl]piperidin-4-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 42955044 |
| Molecular Formula | C22H29FN4O2 |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | N-[1-[1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl]piperidin-4-yl]-4-fluorobenzamide |
| SMILES | CC(C(=O)NC1(C#N)CCCCC1)N1CCC(NC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H29FN4O2/c1-16(20(28)26-22(15-24)11-3-2-4-12-22)27-13-9-19(10-14-27)25-21(29)17-5-7-18(23)8-6-17/h5-8,16,19H,2-4,9-14H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | ZROGOBQDXBOBMS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |