C17H20BrN3O2S — CID 55431922
N-(benzylcarbamoyl)-2-[(5-bromothiophen-2-yl)methyl-methylamino]propanamide (PubChem CID 55431922) has the molecular formula C17H20BrN3O2S and a molecular weight of 410.34 g/mol. Its IUPAC name is N-(benzylcarbamoyl)-2-[(5-bromothiophen-2-yl)methyl-methylamino]propanamide.
| Compound Name | N-(benzylcarbamoyl)-2-[(5-bromothiophen-2-yl)methyl-methylamino]propanamide |
|---|---|
| PubChem CID | 55431922 |
| Molecular Formula | C17H20BrN3O2S |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | N-(benzylcarbamoyl)-2-[(5-bromothiophen-2-yl)methyl-methylamino]propanamide |
| SMILES | CC(C(=O)NC(=O)NCc1ccccc1)N(C)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C17H20BrN3O2S/c1-12(21(2)11-14-8-9-15(18)24-14)16(22)20-17(23)19-10-13-6-4-3-5-7-13/h3-9,12H,10-11H2,1-2H3,(H2,19,20,22,23) |
| InChIKey | UNZSNVQUGIUXTJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |