C17H21ClN2OS — CID 18093995
2-[(5-chlorothiophen-2-yl)methyl-methylamino]-N-[(4-methylphenyl)methyl]propanamide (PubChem CID 18093995) has the molecular formula C17H21ClN2OS and a molecular weight of 336.89 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methyl-methylamino]-N-[(4-methylphenyl)methyl]propanamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methyl-methylamino]-N-[(4-methylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 18093995 |
| Molecular Formula | C17H21ClN2OS |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methyl-methylamino]-N-[(4-methylphenyl)methyl]propanamide |
| SMILES | Cc1ccc(CNC(=O)C(C)N(C)Cc2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C17H21ClN2OS/c1-12-4-6-14(7-5-12)10-19-17(21)13(2)20(3)11-15-8-9-16(18)22-15/h4-9,13H,10-11H2,1-3H3,(H,19,21) |
| InChIKey | QMCGKMVITUPGDR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |