C14H16ClNO3S — CID 71897211
methyl 5-[1-[(5-chlorothiophen-2-yl)methyl-methylamino]ethyl]furan-2-carboxylate (PubChem CID 71897211) has the molecular formula C14H16ClNO3S and a molecular weight of 313.81 g/mol. Its IUPAC name is methyl 5-[1-[(5-chlorothiophen-2-yl)methyl-methylamino]ethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[1-[(5-chlorothiophen-2-yl)methyl-methylamino]ethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 71897211 |
| Molecular Formula | C14H16ClNO3S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | methyl 5-[1-[(5-chlorothiophen-2-yl)methyl-methylamino]ethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(C)N(C)Cc2ccc(Cl)s2)o1 |
| InChI | InChI=1S/C14H16ClNO3S/c1-9(11-5-6-12(19-11)14(17)18-3)16(2)8-10-4-7-13(15)20-10/h4-7,9H,8H2,1-3H3 |
| InChIKey | TWRLNSUYMZVCJS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |