C15H24N2O4 — CID 79084995
methyl 5-[1-[[2-(dimethylamino)-2-oxoethyl]-propylamino]ethyl]furan-2-carboxylate (PubChem CID 79084995) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is methyl 5-[1-[[2-(dimethylamino)-2-oxoethyl]-propylamino]ethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[1-[[2-(dimethylamino)-2-oxoethyl]-propylamino]ethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 79084995 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | methyl 5-[1-[[2-(dimethylamino)-2-oxoethyl]-propylamino]ethyl]furan-2-carboxylate |
| SMILES | CCCN(CC(=O)N(C)C)C(C)c1ccc(C(=O)OC)o1 |
| InChI | InChI=1S/C15H24N2O4/c1-6-9-17(10-14(18)16(3)4)11(2)12-7-8-13(21-12)15(19)20-5/h7-8,11H,6,9-10H2,1-5H3 |
| InChIKey | RPPBFIGODNIRDF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |