C15H23NO3 — CID 107399553
methyl 5-[1-[cyclobutylmethyl(ethyl)amino]ethyl]furan-2-carboxylate (PubChem CID 107399553) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is methyl 5-[1-[cyclobutylmethyl(ethyl)amino]ethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[1-[cyclobutylmethyl(ethyl)amino]ethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 107399553 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | methyl 5-[1-[cyclobutylmethyl(ethyl)amino]ethyl]furan-2-carboxylate |
| SMILES | CCN(CC1CCC1)C(C)c1ccc(C(=O)OC)o1 |
| InChI | InChI=1S/C15H23NO3/c1-4-16(10-12-6-5-7-12)11(2)13-8-9-14(19-13)15(17)18-3/h8-9,11-12H,4-7,10H2,1-3H3 |
| InChIKey | YTOCOSFYALPHIT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |