About ethyl 5-[1-(diethylamino)ethyl]furan-2-carboxylate;iodomethane
ethyl 5-[1-(diethylamino)ethyl]furan-2-carboxylate;iodomethane (PubChem CID 126477205) has the molecular formula C14H24INO3
and a molecular weight of 381.25 g/mol. Its IUPAC name is ethyl 5-[1-(diethylamino)ethyl]furan-2-carboxylate;iodomethane.
Molecular Properties
| Compound Name | ethyl 5-[1-(diethylamino)ethyl]furan-2-carboxylate;iodomethane |
| PubChem CID | 126477205 |
| Molecular Formula | C14H24INO3 |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | ethyl 5-[1-(diethylamino)ethyl]furan-2-carboxylate;iodomethane |
| SMILES | CCOC(=O)c1ccc(C(C)N(CC)CC)o1.CI |
| InChI | InChI=1S/C13H21NO3.CH3I/c1-5-14(6-2)10(4)11-8-9-12(17-11)13(15)16-7-3;1-2/h8-10H,5-7H2,1-4H3;1H3 |
| InChIKey | UBOVNISLGIFFHW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-[1-(diethylamino)ethyl]furan-2-carboxylate;iodomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[1-(diethylamino)ethyl]furan-2-carboxylate;iodomethane?
The IUPAC name of ethyl 5-[1-(diethylamino)ethyl]furan-2-carboxylate;iodomethane (CID 126477205) is ethyl 5-[1-(diethylamino)ethyl]furan-2-carboxylate;iodomethane.
What is the SMILES notation for ethyl 5-[1-(diethylamino)ethyl]furan-2-carboxylate;iodomethane?
The canonical SMILES for ethyl 5-[1-(diethylamino)ethyl]furan-2-carboxylate;iodomethane is CCOC(=O)c1ccc(C(C)N(CC)CC)o1.CI.
What is the InChIKey of ethyl 5-[1-(diethylamino)ethyl]furan-2-carboxylate;iodomethane?
The InChIKey is UBOVNISLGIFFHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO3.CH3I/c1-5-14(6-2)10(4)11-8-9-12(17-11)13(15)16-7-3;1-2/h8-10H,5-7H2,1-4H3;1H3.
What are the key properties of ethyl 5-[1-(diethylamino)ethyl]furan-2-carboxylate;iodomethane?
ethyl 5-[1-(diethylamino)ethyl]furan-2-carboxylate;iodomethane has a molecular weight of 381.25 g/mol, XLogP of 3.91, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[1-(diethylamino)ethyl]furan-2-carboxylate;iodomethane is sourced from PubChem (CID 126477205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).