About ethyl 5-[(1S)-1-amino-2,2,2-trifluoroethyl]furan-2-carboxylate
ethyl 5-[(1S)-1-amino-2,2,2-trifluoroethyl]furan-2-carboxylate (PubChem CID 56971831) has the molecular formula C9H10F3NO3
and a molecular weight of 237.18 g/mol. Its IUPAC name is ethyl 5-[(1S)-1-amino-2,2,2-trifluoroethyl]furan-2-carboxylate.
Analyze ethyl 5-[(1S)-1-amino-2,2,2-trifluoroethyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(1S)-1-amino-2,2,2-trifluoroethyl]furan-2-carboxylate?
The IUPAC name of ethyl 5-[(1S)-1-amino-2,2,2-trifluoroethyl]furan-2-carboxylate (CID 56971831) is ethyl 5-[(1S)-1-amino-2,2,2-trifluoroethyl]furan-2-carboxylate.
What is the SMILES notation for ethyl 5-[(1S)-1-amino-2,2,2-trifluoroethyl]furan-2-carboxylate?
The canonical SMILES for ethyl 5-[(1S)-1-amino-2,2,2-trifluoroethyl]furan-2-carboxylate is CCOC(=O)c1ccc([C@H](N)C(F)(F)F)o1.
What is the InChIKey of ethyl 5-[(1S)-1-amino-2,2,2-trifluoroethyl]furan-2-carboxylate?
The InChIKey is GHTHTECXLLWAKQ-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H10F3NO3/c1-2-15-8(14)6-4-3-5(16-6)7(13)9(10,11)12/h3-4,7H,2,13H2,1H3/t7-/m0/s1.
What are the key properties of ethyl 5-[(1S)-1-amino-2,2,2-trifluoroethyl]furan-2-carboxylate?
ethyl 5-[(1S)-1-amino-2,2,2-trifluoroethyl]furan-2-carboxylate has a molecular weight of 237.18 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(1S)-1-amino-2,2,2-trifluoroethyl]furan-2-carboxylate is sourced from PubChem (CID 56971831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).