C12H18N2O4 — CID 103102938
methyl 5-[1-[(2-amino-2-oxoethyl)-ethylamino]ethyl]furan-2-carboxylate (PubChem CID 103102938) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is methyl 5-[1-[(2-amino-2-oxoethyl)-ethylamino]ethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[1-[(2-amino-2-oxoethyl)-ethylamino]ethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 103102938 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | methyl 5-[1-[(2-amino-2-oxoethyl)-ethylamino]ethyl]furan-2-carboxylate |
| SMILES | CCN(CC(N)=O)C(C)c1ccc(C(=O)OC)o1 |
| InChI | InChI=1S/C12H18N2O4/c1-4-14(7-11(13)15)8(2)9-5-6-10(18-9)12(16)17-3/h5-6,8H,4,7H2,1-3H3,(H2,13,15) |
| InChIKey | QRDDCDDQWPKJCO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |