C14H22N2O4 — CID 79090923
methyl 5-[1-[[2-(methylamino)-2-oxoethyl]-propylamino]ethyl]furan-2-carboxylate (PubChem CID 79090923) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is methyl 5-[1-[[2-(methylamino)-2-oxoethyl]-propylamino]ethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[1-[[2-(methylamino)-2-oxoethyl]-propylamino]ethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 79090923 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | methyl 5-[1-[[2-(methylamino)-2-oxoethyl]-propylamino]ethyl]furan-2-carboxylate |
| SMILES | CCCN(CC(=O)NC)C(C)c1ccc(C(=O)OC)o1 |
| InChI | InChI=1S/C14H22N2O4/c1-5-8-16(9-13(17)15-3)10(2)11-6-7-12(20-11)14(18)19-4/h6-7,10H,5,8-9H2,1-4H3,(H,15,17) |
| InChIKey | FDZSEMCBRKFENS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |