C18H26ClNO — CID 114304371
N-[1-(chloromethyl)-4-methylcyclohexyl]-2-(2,5-dimethylphenyl)acetamide (PubChem CID 114304371) has the molecular formula C18H26ClNO and a molecular weight of 307.86 g/mol. Its IUPAC name is N-[1-(chloromethyl)-4-methylcyclohexyl]-2-(2,5-dimethylphenyl)acetamide.
| Compound Name | N-[1-(chloromethyl)-4-methylcyclohexyl]-2-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 114304371 |
| Molecular Formula | C18H26ClNO |
| Molecular Weight | 307.86 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | N-[1-(chloromethyl)-4-methylcyclohexyl]-2-(2,5-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(C)c(CC(=O)NC2(CCl)CCC(C)CC2)c1 |
| InChI | InChI=1S/C18H26ClNO/c1-13-6-8-18(12-19,9-7-13)20-17(21)11-16-10-14(2)4-5-15(16)3/h4-5,10,13H,6-9,11-12H2,1-3H3,(H,20,21) |
| InChIKey | ZDIDRGFNPBMBHQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.86 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|