C18H27NO2 — CID 130242276
2-(2,5-dimethylphenyl)-N-(4-methoxy-1-methylcyclohexyl)acetamide (PubChem CID 130242276) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-N-(4-methoxy-1-methylcyclohexyl)acetamide.
| Compound Name | 2-(2,5-dimethylphenyl)-N-(4-methoxy-1-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 130242276 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-N-(4-methoxy-1-methylcyclohexyl)acetamide |
| SMILES | COC1CCC(C)(NC(=O)Cc2cc(C)ccc2C)CC1 |
| InChI | InChI=1S/C18H27NO2/c1-13-5-6-14(2)15(11-13)12-17(20)19-18(3)9-7-16(21-4)8-10-18/h5-6,11,16H,7-10,12H2,1-4H3,(H,19,20) |
| InChIKey | SYNQWUOPOMUJOX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |