C19H25NO — CID 7732516
N-(1-adamantyl)-2,5-dimethylbenzamide (PubChem CID 7732516) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is N-(1-adamantyl)-2,5-dimethylbenzamide.
| Compound Name | N-(1-adamantyl)-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 7732516 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | N-(1-adamantyl)-2,5-dimethylbenzamide |
| SMILES | Cc1ccc(C)c(C(=O)NC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C19H25NO/c1-12-3-4-13(2)17(5-12)18(21)20-19-9-14-6-15(10-19)8-16(7-14)11-19/h3-5,14-16H,6-11H2,1-2H3,(H,20,21) |
| InChIKey | ZKNGZKZFTMYEPI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |