C13H14BrNO — CID 172646961
N-(1-bicyclo[1.1.1]pentanyl)-2-bromo-5-methylbenzamide (PubChem CID 172646961) has the molecular formula C13H14BrNO and a molecular weight of 280.16 g/mol. Its IUPAC name is N-(1-bicyclo[1.1.1]pentanyl)-2-bromo-5-methylbenzamide.
| Compound Name | N-(1-bicyclo[1.1.1]pentanyl)-2-bromo-5-methylbenzamide |
|---|---|
| PubChem CID | 172646961 |
| Molecular Formula | C13H14BrNO |
| Molecular Weight | 280.16 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | N-(1-bicyclo[1.1.1]pentanyl)-2-bromo-5-methylbenzamide |
| SMILES | Cc1ccc(Br)c(C(=O)NC23CC(C2)C3)c1 |
| InChI | InChI=1S/C13H14BrNO/c1-8-2-3-11(14)10(4-8)12(16)15-13-5-9(6-13)7-13/h2-4,9H,5-7H2,1H3,(H,15,16) |
| InChIKey | KNALLSZCJVXMSO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.16 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |