C12H10BrF2NO — CID 172646980
N-(1-bicyclo[1.1.1]pentanyl)-5-bromo-2,4-difluorobenzamide (PubChem CID 172646980) has the molecular formula C12H10BrF2NO and a molecular weight of 302.12 g/mol. Its IUPAC name is N-(1-bicyclo[1.1.1]pentanyl)-5-bromo-2,4-difluorobenzamide.
| Compound Name | N-(1-bicyclo[1.1.1]pentanyl)-5-bromo-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 172646980 |
| Molecular Formula | C12H10BrF2NO |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | N-(1-bicyclo[1.1.1]pentanyl)-5-bromo-2,4-difluorobenzamide |
| SMILES | O=C(NC12CC(C1)C2)c1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C12H10BrF2NO/c13-8-1-7(9(14)2-10(8)15)11(17)16-12-3-6(4-12)5-12/h1-2,6H,3-5H2,(H,16,17) |
| InChIKey | WUYZTJZJEDAGMB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|