C13H11BrF3NO — CID 172646989
N-(1-bicyclo[1.1.1]pentanyl)-3-bromo-5-(trifluoromethyl)benzamide (PubChem CID 172646989) has the molecular formula C13H11BrF3NO and a molecular weight of 334.14 g/mol. Its IUPAC name is N-(1-bicyclo[1.1.1]pentanyl)-3-bromo-5-(trifluoromethyl)benzamide.
| Compound Name | N-(1-bicyclo[1.1.1]pentanyl)-3-bromo-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 172646989 |
| Molecular Formula | C13H11BrF3NO |
| Molecular Weight | 334.14 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | N-(1-bicyclo[1.1.1]pentanyl)-3-bromo-5-(trifluoromethyl)benzamide |
| SMILES | O=C(NC12CC(C1)C2)c1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H11BrF3NO/c14-10-2-8(1-9(3-10)13(15,16)17)11(19)18-12-4-7(5-12)6-12/h1-3,7H,4-6H2,(H,18,19) |
| InChIKey | MRCQMUSCFNIVCC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.14 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |