C22H26N2O6 — CID 4789040
4-ethoxy-3-methoxy-N'-[4-(oxolan-2-ylmethoxy)benzoyl]benzohydrazide (PubChem CID 4789040) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is 4-ethoxy-3-methoxy-N'-[4-(oxolan-2-ylmethoxy)benzoyl]benzohydrazide.
| Compound Name | 4-ethoxy-3-methoxy-N'-[4-(oxolan-2-ylmethoxy)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 4789040 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 4-ethoxy-3-methoxy-N'-[4-(oxolan-2-ylmethoxy)benzoyl]benzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)c2ccc(OCC3CCCO3)cc2)cc1OC |
| InChI | InChI=1S/C22H26N2O6/c1-3-28-19-11-8-16(13-20(19)27-2)22(26)24-23-21(25)15-6-9-17(10-7-15)30-14-18-5-4-12-29-18/h6-11,13,18H,3-5,12,14H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | FCOSZDIZTMFWDN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|