C17H18N6O3 — CID 55998602
3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 3-(pyrimidin-2-ylamino)propanoate (PubChem CID 55998602) has the molecular formula C17H18N6O3 and a molecular weight of 354.37 g/mol. Its IUPAC name is 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 3-(pyrimidin-2-ylamino)propanoate.
| Compound Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 3-(pyrimidin-2-ylamino)propanoate |
|---|---|
| PubChem CID | 55998602 |
| Molecular Formula | C17H18N6O3 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 3-(pyrimidin-2-ylamino)propanoate |
| SMILES | O=C(CCNc1ncccn1)OCCCc1nc(-c2cccnc2)no1 |
| InChI | InChI=1S/C17H18N6O3/c24-15(6-10-21-17-19-8-3-9-20-17)25-11-2-5-14-22-16(23-26-14)13-4-1-7-18-12-13/h1,3-4,7-9,12H,2,5-6,10-11H2,(H,19,20,21) |
| InChIKey | QSDVNEVOSPPMID-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|