C21H17ClN4O4S — CID 55568697
3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate (PubChem CID 55568697) has the molecular formula C21H17ClN4O4S and a molecular weight of 456.91 g/mol. Its IUPAC name is 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate.
| Compound Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 55568697 |
| Molecular Formula | C21H17ClN4O4S |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1sc2ccccc2c1Cl)OCCCc1nc(-c2cccnc2)no1 |
| InChI | InChI=1S/C21H17ClN4O4S/c22-18-14-6-1-2-7-15(14)31-19(18)21(28)24-12-17(27)29-10-4-8-16-25-20(26-30-16)13-5-3-9-23-11-13/h1-3,5-7,9,11H,4,8,10,12H2,(H,24,28) |
| InChIKey | QIXCOUDYZRKWJI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|