C24H20N2O3 — CID 59297720
methyl 3-(2-cyanophenyl)-5-[[(1R)-1-phenylethyl]carbamoyl]benzoate (PubChem CID 59297720) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is methyl 3-(2-cyanophenyl)-5-[[(1R)-1-phenylethyl]carbamoyl]benzoate.
| Compound Name | methyl 3-(2-cyanophenyl)-5-[[(1R)-1-phenylethyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 59297720 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | methyl 3-(2-cyanophenyl)-5-[[(1R)-1-phenylethyl]carbamoyl]benzoate |
| SMILES | COC(=O)c1cc(C(=O)N[C@H](C)c2ccccc2)cc(-c2ccccc2C#N)c1 |
| InChI | InChI=1S/C24H20N2O3/c1-16(17-8-4-3-5-9-17)26-23(27)20-12-19(13-21(14-20)24(28)29-2)22-11-7-6-10-18(22)15-25/h3-14,16H,1-2H3,(H,26,27)/t16-/m1/s1 |
| InChIKey | LAEYHWDBIHDUDD-MRXNPFEDSA-N |
| XLogP | 4.50 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |