C29H32N4O3 — CID 23647285
3-[2-(5-aminopentylamino)-2-oxoethoxy]-5-(2-cyanophenyl)-N-[(1R)-1-phenylethyl]benzamide (PubChem CID 23647285) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is 3-[2-(5-aminopentylamino)-2-oxoethoxy]-5-(2-cyanophenyl)-N-[(1R)-1-phenylethyl]benzamide.
| Compound Name | 3-[2-(5-aminopentylamino)-2-oxoethoxy]-5-(2-cyanophenyl)-N-[(1R)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 23647285 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 3-[2-(5-aminopentylamino)-2-oxoethoxy]-5-(2-cyanophenyl)-N-[(1R)-1-phenylethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1cc(OCC(=O)NCCCCCN)cc(-c2ccccc2C#N)c1)c1ccccc1 |
| InChI | InChI=1S/C29H32N4O3/c1-21(22-10-4-2-5-11-22)33-29(35)25-16-24(27-13-7-6-12-23(27)19-31)17-26(18-25)36-20-28(34)32-15-9-3-8-14-30/h2,4-7,10-13,16-18,21H,3,8-9,14-15,20,30H2,1H3,(H,32,34)(H,33,35)/t21-/m1/s1 |
| InChIKey | YUEZQFWNMDKTLS-OAQYLSRUSA-N |
| XLogP | 4.34 |
| TPSA | 117.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|