C18H19N3O7S — CID 55711483
methyl 3-[1-[3-(methanesulfonamido)phenyl]ethylcarbamoyl]-5-nitrobenzoate (PubChem CID 55711483) has the molecular formula C18H19N3O7S and a molecular weight of 421.43 g/mol. Its IUPAC name is methyl 3-[1-[3-(methanesulfonamido)phenyl]ethylcarbamoyl]-5-nitrobenzoate.
| Compound Name | methyl 3-[1-[3-(methanesulfonamido)phenyl]ethylcarbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 55711483 |
| Molecular Formula | C18H19N3O7S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | methyl 3-[1-[3-(methanesulfonamido)phenyl]ethylcarbamoyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(=O)NC(C)c2cccc(NS(C)(=O)=O)c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19N3O7S/c1-11(12-5-4-6-15(8-12)20-29(3,26)27)19-17(22)13-7-14(18(23)28-2)10-16(9-13)21(24)25/h4-11,20H,1-3H3,(H,19,22) |
| InChIKey | HSVXOBKSYIKANG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|