C16H15Cl2O4P — CID 137391212
2,6-dichloro-4-[2-[(3-hydroxyphenyl)-methylphosphoryl]ethyl]benzoic acid (PubChem CID 137391212) has the molecular formula C16H15Cl2O4P and a molecular weight of 373.17 g/mol. Its IUPAC name is 2,6-dichloro-4-[2-[(3-hydroxyphenyl)-methylphosphoryl]ethyl]benzoic acid.
| Compound Name | 2,6-dichloro-4-[2-[(3-hydroxyphenyl)-methylphosphoryl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 137391212 |
| Molecular Formula | C16H15Cl2O4P |
| Molecular Weight | 373.17 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 2,6-dichloro-4-[2-[(3-hydroxyphenyl)-methylphosphoryl]ethyl]benzoic acid |
| SMILES | CP(=O)(CCc1cc(Cl)c(C(=O)O)c(Cl)c1)c1cccc(O)c1 |
| InChI | InChI=1S/C16H15Cl2O4P/c1-23(22,12-4-2-3-11(19)9-12)6-5-10-7-13(17)15(16(20)21)14(18)8-10/h2-4,7-9,19H,5-6H2,1H3,(H,20,21) |
| InChIKey | BOSPHXFYYSFYDP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.17 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|