C31H30Cl2NO6PS — CID 137391254
4-[2-bis(3-hydroxyphenyl)phosphorylethyl]-2,6-dichloro-N-[1-(3-methylsulfonylphenyl)propan-2-yl]benzamide (PubChem CID 137391254) has the molecular formula C31H30Cl2NO6PS and a molecular weight of 646.53 g/mol. Its IUPAC name is 4-[2-bis(3-hydroxyphenyl)phosphorylethyl]-2,6-dichloro-N-[1-(3-methylsulfonylphenyl)propan-2-yl]benzamide.
| Compound Name | 4-[2-bis(3-hydroxyphenyl)phosphorylethyl]-2,6-dichloro-N-[1-(3-methylsulfonylphenyl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 137391254 |
| Molecular Formula | C31H30Cl2NO6PS |
| Molecular Weight | 646.53 g/mol |
| Exact Mass | 645.09 |
| IUPAC Name | 4-[2-bis(3-hydroxyphenyl)phosphorylethyl]-2,6-dichloro-N-[1-(3-methylsulfonylphenyl)propan-2-yl]benzamide |
| SMILES | CC(Cc1cccc(S(C)(=O)=O)c1)NC(=O)c1c(Cl)cc(CCP(=O)(c2cccc(O)c2)c2cccc(O)c2)cc1Cl |
| InChI | InChI=1S/C31H30Cl2NO6PS/c1-20(14-21-6-3-11-27(15-21)42(2,39)40)34-31(37)30-28(32)16-22(17-29(30)33)12-13-41(38,25-9-4-7-23(35)18-25)26-10-5-8-24(36)19-26/h3-11,15-20,35-36H,12-14H2,1-2H3,(H,34,37) |
| InChIKey | WQXSJLOXDRRPHR-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|