C25H26Cl2NO7PS — CID 150627948
(2S)-2-[2,6-dichloro-4-[2-[(3-hydroxyphenyl)-methoxyphosphoryl]ethyl]anilino]-3-(3-methylsulfonylphenyl)propanoic acid (PubChem CID 150627948) has the molecular formula C25H26Cl2NO7PS and a molecular weight of 586.43 g/mol. Its IUPAC name is (2S)-2-[2,6-dichloro-4-[2-[(3-hydroxyphenyl)-methoxyphosphoryl]ethyl]anilino]-3-(3-methylsulfonylphenyl)propanoic acid.
| Compound Name | (2S)-2-[2,6-dichloro-4-[2-[(3-hydroxyphenyl)-methoxyphosphoryl]ethyl]anilino]-3-(3-methylsulfonylphenyl)propanoic acid |
|---|---|
| PubChem CID | 150627948 |
| Molecular Formula | C25H26Cl2NO7PS |
| Molecular Weight | 586.43 g/mol |
| Exact Mass | 585.05 |
| IUPAC Name | (2S)-2-[2,6-dichloro-4-[2-[(3-hydroxyphenyl)-methoxyphosphoryl]ethyl]anilino]-3-(3-methylsulfonylphenyl)propanoic acid |
| SMILES | COP(=O)(CCc1cc(Cl)c(N[C@@H](Cc2cccc(S(C)(=O)=O)c2)C(=O)O)c(Cl)c1)c1cccc(O)c1 |
| InChI | InChI=1S/C25H26Cl2NO7PS/c1-35-36(32,19-7-4-6-18(29)15-19)10-9-17-12-21(26)24(22(27)13-17)28-23(25(30)31)14-16-5-3-8-20(11-16)37(2,33)34/h3-8,11-13,15,23,28-29H,9-10,14H2,1-2H3,(H,30,31)/t23-,36?/m0/s1 |
| InChIKey | IXGYUHMRQIQRKN-IRUXJXNPSA-N |
| XLogP | 5.00 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|