C33H30Cl2NO8PS — CID 146551749
2-[3,5-dichloro-4-[hydroxy-[[(2S)-3-(3-methylsulfonylphenyl)-1-oxo-1-phenylmethoxypropan-2-yl]amino]methyl]phenyl]ethynyl-(3-methoxyphenyl)phosphinic acid (PubChem CID 146551749) has the molecular formula C33H30Cl2NO8PS and a molecular weight of 702.55 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[hydroxy-[[(2S)-3-(3-methylsulfonylphenyl)-1-oxo-1-phenylmethoxypropan-2-yl]amino]methyl]phenyl]ethynyl-(3-methoxyphenyl)phosphinic acid.
| Compound Name | 2-[3,5-dichloro-4-[hydroxy-[[(2S)-3-(3-methylsulfonylphenyl)-1-oxo-1-phenylmethoxypropan-2-yl]amino]methyl]phenyl]ethynyl-(3-methoxyphenyl)phosphinic acid |
|---|---|
| PubChem CID | 146551749 |
| Molecular Formula | C33H30Cl2NO8PS |
| Molecular Weight | 702.55 g/mol |
| Exact Mass | 701.08 |
| IUPAC Name | 2-[3,5-dichloro-4-[hydroxy-[[(2S)-3-(3-methylsulfonylphenyl)-1-oxo-1-phenylmethoxypropan-2-yl]amino]methyl]phenyl]ethynyl-(3-methoxyphenyl)phosphinic acid |
| SMILES | COc1cccc(P(=O)(O)C#Cc2cc(Cl)c(C(O)N[C@@H](Cc3cccc(S(C)(=O)=O)c3)C(=O)OCc3ccccc3)c(Cl)c2)c1 |
| InChI | InChI=1S/C33H30Cl2NO8PS/c1-43-25-11-7-12-26(20-25)45(39,40)15-14-24-17-28(34)31(29(35)18-24)32(37)36-30(33(38)44-21-22-8-4-3-5-9-22)19-23-10-6-13-27(16-23)46(2,41)42/h3-13,16-18,20,30,32,36-37H,19,21H2,1-2H3,(H,39,40)/t30-,32?/m0/s1 |
| InChIKey | XNZFBVDALNSDDQ-TZYYSAMKSA-N |
| XLogP | 5.25 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.55 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|