C26H22Cl2NO5PS — CID 137391525
(2S)-2-[[2,6-dichloro-4-[2-[methyl(phenyl)phosphanyl]ethynyl]benzoyl]amino]-3-(3-methylsulfonylphenyl)propanoic acid (PubChem CID 137391525) has the molecular formula C26H22Cl2NO5PS and a molecular weight of 562.41 g/mol. Its IUPAC name is (2S)-2-[[2,6-dichloro-4-[2-[methyl(phenyl)phosphanyl]ethynyl]benzoyl]amino]-3-(3-methylsulfonylphenyl)propanoic acid.
| Compound Name | (2S)-2-[[2,6-dichloro-4-[2-[methyl(phenyl)phosphanyl]ethynyl]benzoyl]amino]-3-(3-methylsulfonylphenyl)propanoic acid |
|---|---|
| PubChem CID | 137391525 |
| Molecular Formula | C26H22Cl2NO5PS |
| Molecular Weight | 562.41 g/mol |
| Exact Mass | 561.03 |
| IUPAC Name | (2S)-2-[[2,6-dichloro-4-[2-[methyl(phenyl)phosphanyl]ethynyl]benzoyl]amino]-3-(3-methylsulfonylphenyl)propanoic acid |
| SMILES | CP(C#Cc1cc(Cl)c(C(=O)N[C@@H](Cc2cccc(S(C)(=O)=O)c2)C(=O)O)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C26H22Cl2NO5PS/c1-35(19-8-4-3-5-9-19)12-11-18-14-21(27)24(22(28)15-18)25(30)29-23(26(31)32)16-17-7-6-10-20(13-17)36(2,33)34/h3-10,13-15,23H,16H2,1-2H3,(H,29,30)(H,31,32)/t23-,35?/m0/s1 |
| InChIKey | AJUMTWGIIKDUFY-MYJVBWMHSA-N |
| XLogP | 4.57 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|