C26H19Cl2F2NO6S — CID 118201112
(2S)-2-[[2,6-dichloro-4-[(E)-3-(2,6-difluorophenyl)prop-2-enoyl]benzoyl]amino]-3-(3-methylsulfonylphenyl)propanoic acid (PubChem CID 118201112) has the molecular formula C26H19Cl2F2NO6S and a molecular weight of 582.41 g/mol. Its IUPAC name is (2S)-2-[[2,6-dichloro-4-[(E)-3-(2,6-difluorophenyl)prop-2-enoyl]benzoyl]amino]-3-(3-methylsulfonylphenyl)propanoic acid.
| Compound Name | (2S)-2-[[2,6-dichloro-4-[(E)-3-(2,6-difluorophenyl)prop-2-enoyl]benzoyl]amino]-3-(3-methylsulfonylphenyl)propanoic acid |
|---|---|
| PubChem CID | 118201112 |
| Molecular Formula | C26H19Cl2F2NO6S |
| Molecular Weight | 582.41 g/mol |
| Exact Mass | 581.03 |
| IUPAC Name | (2S)-2-[[2,6-dichloro-4-[(E)-3-(2,6-difluorophenyl)prop-2-enoyl]benzoyl]amino]-3-(3-methylsulfonylphenyl)propanoic acid |
| SMILES | CS(=O)(=O)c1cccc(C[C@H](NC(=O)c2c(Cl)cc(C(=O)/C=C/c3c(F)cccc3F)cc2Cl)C(=O)O)c1 |
| InChI | InChI=1S/C26H19Cl2F2NO6S/c1-38(36,37)16-5-2-4-14(10-16)11-22(26(34)35)31-25(33)24-18(27)12-15(13-19(24)28)23(32)9-8-17-20(29)6-3-7-21(17)30/h2-10,12-13,22H,11H2,1H3,(H,31,33)(H,34,35)/b9-8+/t22-/m0/s1 |
| InChIKey | LIBPNGYPTXHTHP-UVIRAJKCSA-N |
| XLogP | 5.00 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|