C11H15NO5S — CID 155323105
(2S)-2-(hydroxymethylamino)-3-(3-methylsulfonylphenyl)propanoic acid (PubChem CID 155323105) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is (2S)-2-(hydroxymethylamino)-3-(3-methylsulfonylphenyl)propanoic acid.
| Compound Name | (2S)-2-(hydroxymethylamino)-3-(3-methylsulfonylphenyl)propanoic acid |
|---|---|
| PubChem CID | 155323105 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | (2S)-2-(hydroxymethylamino)-3-(3-methylsulfonylphenyl)propanoic acid |
| SMILES | CS(=O)(=O)c1cccc(C[C@H](NCO)C(=O)O)c1 |
| InChI | InChI=1S/C11H15NO5S/c1-18(16,17)9-4-2-3-8(5-9)6-10(11(14)15)12-7-13/h2-5,10,12-13H,6-7H2,1H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | GYAYDJSYYSDKMT-JTQLQIEISA-N |
| XLogP | -0.37 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|