C11H13NO4S — CID 129141679
(2S)-2-(methylideneamino)-3-(3-methylsulfonylphenyl)propanoic acid (PubChem CID 129141679) has the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. Its IUPAC name is (2S)-2-(methylideneamino)-3-(3-methylsulfonylphenyl)propanoic acid.
| Compound Name | (2S)-2-(methylideneamino)-3-(3-methylsulfonylphenyl)propanoic acid |
|---|---|
| PubChem CID | 129141679 |
| Molecular Formula | C11H13NO4S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | (2S)-2-(methylideneamino)-3-(3-methylsulfonylphenyl)propanoic acid |
| SMILES | C=N[C@@H](Cc1cccc(S(C)(=O)=O)c1)C(=O)O |
| InChI | InChI=1S/C11H13NO4S/c1-12-10(11(13)14)7-8-4-3-5-9(6-8)17(2,15)16/h3-6,10H,1,7H2,2H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | OLOLJLFCXFACTF-JTQLQIEISA-N |
| XLogP | 0.79 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|