C17H21NO3S — CID 123390478
1-(3-methylsulfonylphenyl)-3-phenylmethoxypropan-2-amine (PubChem CID 123390478) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-(3-methylsulfonylphenyl)-3-phenylmethoxypropan-2-amine.
| Compound Name | 1-(3-methylsulfonylphenyl)-3-phenylmethoxypropan-2-amine |
|---|---|
| PubChem CID | 123390478 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-(3-methylsulfonylphenyl)-3-phenylmethoxypropan-2-amine |
| SMILES | CS(=O)(=O)c1cccc(CC(N)COCc2ccccc2)c1 |
| InChI | InChI=1S/C17H21NO3S/c1-22(19,20)17-9-5-8-15(11-17)10-16(18)13-21-12-14-6-3-2-4-7-14/h2-9,11,16H,10,12-13,18H2,1H3 |
| InChIKey | NBUAWMMGJPKKKA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |