About (2S)-4-methyl-1-phenylmethoxypentan-2-amine;sulfane
(2S)-4-methyl-1-phenylmethoxypentan-2-amine;sulfane (PubChem CID 158419681) has the molecular formula C13H23NOS
and a molecular weight of 241.40 g/mol. Its IUPAC name is (2S)-4-methyl-1-phenylmethoxypentan-2-amine;sulfane.
Molecular Properties
| Compound Name | (2S)-4-methyl-1-phenylmethoxypentan-2-amine;sulfane |
| PubChem CID | 158419681 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (2S)-4-methyl-1-phenylmethoxypentan-2-amine;sulfane |
| SMILES | CC(C)C[C@H](N)COCc1ccccc1.S |
| InChI | InChI=1S/C13H21NO.H2S/c1-11(2)8-13(14)10-15-9-12-6-4-3-5-7-12;/h3-7,11,13H,8-10,14H2,1-2H3;1H2/t13-;/m0./s1 |
| InChIKey | HAIKEIXPFJDOBA-ZOWNYOTGSA-N |
| XLogP | 2.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-4-methyl-1-phenylmethoxypentan-2-amine;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-methyl-1-phenylmethoxypentan-2-amine;sulfane?
The IUPAC name of (2S)-4-methyl-1-phenylmethoxypentan-2-amine;sulfane (CID 158419681) is (2S)-4-methyl-1-phenylmethoxypentan-2-amine;sulfane.
What is the SMILES notation for (2S)-4-methyl-1-phenylmethoxypentan-2-amine;sulfane?
The canonical SMILES for (2S)-4-methyl-1-phenylmethoxypentan-2-amine;sulfane is CC(C)C[C@H](N)COCc1ccccc1.S.
What is the InChIKey of (2S)-4-methyl-1-phenylmethoxypentan-2-amine;sulfane?
The InChIKey is HAIKEIXPFJDOBA-ZOWNYOTGSA-N. The full InChI is InChI=1S/C13H21NO.H2S/c1-11(2)8-13(14)10-15-9-12-6-4-3-5-7-12;/h3-7,11,13H,8-10,14H2,1-2H3;1H2/t13-;/m0./s1.
What are the key properties of (2S)-4-methyl-1-phenylmethoxypentan-2-amine;sulfane?
(2S)-4-methyl-1-phenylmethoxypentan-2-amine;sulfane has a molecular weight of 241.40 g/mol, XLogP of 2.69, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-methyl-1-phenylmethoxypentan-2-amine;sulfane is sourced from PubChem (CID 158419681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).