C24H26Cl2NO7PS — CID 146579555
(2S)-2-[[(2Z)-3-chloro-2-[2-chloro-2-[methoxy(phenyl)phosphoryl]ethyl]penta-2,4-dienoyl]amino]-3-(3-methylsulfonylphenyl)propanoic acid (PubChem CID 146579555) has the molecular formula C24H26Cl2NO7PS and a molecular weight of 574.42 g/mol. Its IUPAC name is (2S)-2-[[(2Z)-3-chloro-2-[2-chloro-2-[methoxy(phenyl)phosphoryl]ethyl]penta-2,4-dienoyl]amino]-3-(3-methylsulfonylphenyl)propanoic acid.
| Compound Name | (2S)-2-[[(2Z)-3-chloro-2-[2-chloro-2-[methoxy(phenyl)phosphoryl]ethyl]penta-2,4-dienoyl]amino]-3-(3-methylsulfonylphenyl)propanoic acid |
|---|---|
| PubChem CID | 146579555 |
| Molecular Formula | C24H26Cl2NO7PS |
| Molecular Weight | 574.42 g/mol |
| Exact Mass | 573.05 |
| IUPAC Name | (2S)-2-[[(2Z)-3-chloro-2-[2-chloro-2-[methoxy(phenyl)phosphoryl]ethyl]penta-2,4-dienoyl]amino]-3-(3-methylsulfonylphenyl)propanoic acid |
| SMILES | C=C/C(Cl)=C(\CC(Cl)P(=O)(OC)c1ccccc1)C(=O)N[C@@H](Cc1cccc(S(C)(=O)=O)c1)C(=O)O |
| InChI | InChI=1S/C24H26Cl2NO7PS/c1-4-20(25)19(15-22(26)35(31,34-2)17-10-6-5-7-11-17)23(28)27-21(24(29)30)14-16-9-8-12-18(13-16)36(3,32)33/h4-13,21-22H,1,14-15H2,2-3H3,(H,27,28)(H,29,30)/b20-19-/t21-,22?,35?/m0/s1 |
| InChIKey | ZLSUVXVJWVTWRN-ZFVVNYPFSA-N |
| XLogP | 4.09 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|