C25H31Cl2N2O4PS — CID 137391568
2,6-dichloro-4-[2-[(3-hydroxyphenyl)-methylphosphanyl]ethyl]-N-[1-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-5-yl)propan-2-yl]benzamide (PubChem CID 137391568) has the molecular formula C25H31Cl2N2O4PS and a molecular weight of 557.48 g/mol. Its IUPAC name is 2,6-dichloro-4-[2-[(3-hydroxyphenyl)-methylphosphanyl]ethyl]-N-[1-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-5-yl)propan-2-yl]benzamide.
| Compound Name | 2,6-dichloro-4-[2-[(3-hydroxyphenyl)-methylphosphanyl]ethyl]-N-[1-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-5-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 137391568 |
| Molecular Formula | C25H31Cl2N2O4PS |
| Molecular Weight | 557.48 g/mol |
| Exact Mass | 556.11 |
| IUPAC Name | 2,6-dichloro-4-[2-[(3-hydroxyphenyl)-methylphosphanyl]ethyl]-N-[1-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-5-yl)propan-2-yl]benzamide |
| SMILES | CC(CC1=CCCN(S(C)(=O)=O)C1)NC(=O)c1c(Cl)cc(CCP(C)c2cccc(O)c2)cc1Cl |
| InChI | InChI=1S/C25H31Cl2N2O4PS/c1-17(12-19-6-5-10-29(16-19)35(3,32)33)28-25(31)24-22(26)13-18(14-23(24)27)9-11-34(2)21-8-4-7-20(30)15-21/h4,6-8,13-15,17,30H,5,9-12,16H2,1-3H3,(H,28,31) |
| InChIKey | JWUUFXXHBKXHEY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|