C17H14Cl2N2O2 — CID 143677108
[4-[2-[(2,6-dichlorobenzoyl)amino]propyl]phenyl] cyanate (PubChem CID 143677108) has the molecular formula C17H14Cl2N2O2 and a molecular weight of 349.22 g/mol. Its IUPAC name is [4-[2-[(2,6-dichlorobenzoyl)amino]propyl]phenyl] cyanate.
| Compound Name | [4-[2-[(2,6-dichlorobenzoyl)amino]propyl]phenyl] cyanate |
|---|---|
| PubChem CID | 143677108 |
| Molecular Formula | C17H14Cl2N2O2 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | [4-[2-[(2,6-dichlorobenzoyl)amino]propyl]phenyl] cyanate |
| SMILES | CC(Cc1ccc(OC#N)cc1)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H14Cl2N2O2/c1-11(9-12-5-7-13(8-6-12)23-10-20)21-17(22)16-14(18)3-2-4-15(16)19/h2-8,11H,9H2,1H3,(H,21,22) |
| InChIKey | NLFFDKRLWLVZOW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|