C25H32Cl2N2O2 — CID 23531303
2,6-dichloro-N-[4-[2-[(2-ethyl-2-methylhexanoyl)amino]propyl]phenyl]benzamide (PubChem CID 23531303) has the molecular formula C25H32Cl2N2O2 and a molecular weight of 463.45 g/mol. Its IUPAC name is 2,6-dichloro-N-[4-[2-[(2-ethyl-2-methylhexanoyl)amino]propyl]phenyl]benzamide.
| Compound Name | 2,6-dichloro-N-[4-[2-[(2-ethyl-2-methylhexanoyl)amino]propyl]phenyl]benzamide |
|---|---|
| PubChem CID | 23531303 |
| Molecular Formula | C25H32Cl2N2O2 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 2,6-dichloro-N-[4-[2-[(2-ethyl-2-methylhexanoyl)amino]propyl]phenyl]benzamide |
| SMILES | CCCCC(C)(CC)C(=O)NC(C)Cc1ccc(NC(=O)c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C25H32Cl2N2O2/c1-5-7-15-25(4,6-2)24(31)28-17(3)16-18-11-13-19(14-12-18)29-23(30)22-20(26)9-8-10-21(22)27/h8-14,17H,5-7,15-16H2,1-4H3,(H,28,31)(H,29,30) |
| InChIKey | WSKBDLUKYNILCI-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |