C26H35N3O4 — CID 23531252
N-[4-[2-[(2-ethyl-2-methylhexanoyl)amino]propyl]phenyl]-2-methyl-5-nitrobenzamide (PubChem CID 23531252) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is N-[4-[2-[(2-ethyl-2-methylhexanoyl)amino]propyl]phenyl]-2-methyl-5-nitrobenzamide.
| Compound Name | N-[4-[2-[(2-ethyl-2-methylhexanoyl)amino]propyl]phenyl]-2-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 23531252 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | N-[4-[2-[(2-ethyl-2-methylhexanoyl)amino]propyl]phenyl]-2-methyl-5-nitrobenzamide |
| SMILES | CCCCC(C)(CC)C(=O)NC(C)Cc1ccc(NC(=O)c2cc([N+](=O)[O-])ccc2C)cc1 |
| InChI | InChI=1S/C26H35N3O4/c1-6-8-15-26(5,7-2)25(31)27-19(4)16-20-10-12-21(13-11-20)28-24(30)23-17-22(29(32)33)14-9-18(23)3/h9-14,17,19H,6-8,15-16H2,1-5H3,(H,27,31)(H,28,30) |
| InChIKey | HKYDIWLZPJKUOJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|