C31H33N3O7 — CID 22660191
2-[[1-[(4-methoxyphenyl)methyl]cyclopentanecarbonyl]amino]-3-[4-[(2-methyl-5-nitrobenzoyl)amino]phenyl]propanoic acid (PubChem CID 22660191) has the molecular formula C31H33N3O7 and a molecular weight of 559.62 g/mol. Its IUPAC name is 2-[[1-[(4-methoxyphenyl)methyl]cyclopentanecarbonyl]amino]-3-[4-[(2-methyl-5-nitrobenzoyl)amino]phenyl]propanoic acid.
| Compound Name | 2-[[1-[(4-methoxyphenyl)methyl]cyclopentanecarbonyl]amino]-3-[4-[(2-methyl-5-nitrobenzoyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22660191 |
| Molecular Formula | C31H33N3O7 |
| Molecular Weight | 559.62 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | 2-[[1-[(4-methoxyphenyl)methyl]cyclopentanecarbonyl]amino]-3-[4-[(2-methyl-5-nitrobenzoyl)amino]phenyl]propanoic acid |
| SMILES | COc1ccc(CC2(C(=O)NC(Cc3ccc(NC(=O)c4cc([N+](=O)[O-])ccc4C)cc3)C(=O)O)CCCC2)cc1 |
| InChI | InChI=1S/C31H33N3O7/c1-20-5-12-24(34(39)40)18-26(20)28(35)32-23-10-6-21(7-11-23)17-27(29(36)37)33-30(38)31(15-3-4-16-31)19-22-8-13-25(41-2)14-9-22/h5-14,18,27H,3-4,15-17,19H2,1-2H3,(H,32,35)(H,33,38)(H,36,37) |
| InChIKey | QBXKRFRYQAFVKL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.62 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|