C31H35N3O5 — CID 23531313
N-[4-[2-[[1-[(4-methoxyphenyl)methyl]cyclopentanecarbonyl]amino]propyl]phenyl]-2-methyl-5-nitrobenzamide (PubChem CID 23531313) has the molecular formula C31H35N3O5 and a molecular weight of 529.64 g/mol. Its IUPAC name is N-[4-[2-[[1-[(4-methoxyphenyl)methyl]cyclopentanecarbonyl]amino]propyl]phenyl]-2-methyl-5-nitrobenzamide.
| Compound Name | N-[4-[2-[[1-[(4-methoxyphenyl)methyl]cyclopentanecarbonyl]amino]propyl]phenyl]-2-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 23531313 |
| Molecular Formula | C31H35N3O5 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | N-[4-[2-[[1-[(4-methoxyphenyl)methyl]cyclopentanecarbonyl]amino]propyl]phenyl]-2-methyl-5-nitrobenzamide |
| SMILES | COc1ccc(CC2(C(=O)NC(C)Cc3ccc(NC(=O)c4cc([N+](=O)[O-])ccc4C)cc3)CCCC2)cc1 |
| InChI | InChI=1S/C31H35N3O5/c1-21-6-13-26(34(37)38)19-28(21)29(35)33-25-11-7-23(8-12-25)18-22(2)32-30(36)31(16-4-5-17-31)20-24-9-14-27(39-3)15-10-24/h6-15,19,22H,4-5,16-18,20H2,1-3H3,(H,32,36)(H,33,35) |
| InChIKey | HXDWPZKEIVGCRO-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|