C21H22Cl2N2O4S — CID 177314841
5,7-dichloro-2-formyl-N-[1-(3-methylsulfonylphenyl)propan-2-yl]-3,4-dihydro-1H-isoquinoline-6-carboxamide (PubChem CID 177314841) has the molecular formula C21H22Cl2N2O4S and a molecular weight of 469.39 g/mol. Its IUPAC name is 5,7-dichloro-2-formyl-N-[1-(3-methylsulfonylphenyl)propan-2-yl]-3,4-dihydro-1H-isoquinoline-6-carboxamide.
| Compound Name | 5,7-dichloro-2-formyl-N-[1-(3-methylsulfonylphenyl)propan-2-yl]-3,4-dihydro-1H-isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 177314841 |
| Molecular Formula | C21H22Cl2N2O4S |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 5,7-dichloro-2-formyl-N-[1-(3-methylsulfonylphenyl)propan-2-yl]-3,4-dihydro-1H-isoquinoline-6-carboxamide |
| SMILES | CC(Cc1cccc(S(C)(=O)=O)c1)NC(=O)c1c(Cl)cc2c(c1Cl)CCN(C=O)C2 |
| InChI | InChI=1S/C21H22Cl2N2O4S/c1-13(8-14-4-3-5-16(9-14)30(2,28)29)24-21(27)19-18(22)10-15-11-25(12-26)7-6-17(15)20(19)23/h3-5,9-10,12-13H,6-8,11H2,1-2H3,(H,24,27) |
| InChIKey | FOSLGMWYPCDHPQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|