C16H16Cl2O4P+ — CID 146579848
2-(4-carboxy-3,5-dichlorophenyl)ethyl-hydroxy-(3-hydroxyphenyl)-methylphosphanium (PubChem CID 146579848) has the molecular formula C16H16Cl2O4P+ and a molecular weight of 374.18 g/mol. Its IUPAC name is 2-(4-carboxy-3,5-dichlorophenyl)ethyl-hydroxy-(3-hydroxyphenyl)-methylphosphanium.
| Compound Name | 2-(4-carboxy-3,5-dichlorophenyl)ethyl-hydroxy-(3-hydroxyphenyl)-methylphosphanium |
|---|---|
| PubChem CID | 146579848 |
| Molecular Formula | C16H16Cl2O4P+ |
| Molecular Weight | 374.18 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 2-(4-carboxy-3,5-dichlorophenyl)ethyl-hydroxy-(3-hydroxyphenyl)-methylphosphanium |
| SMILES | C[P+](O)(CCc1cc(Cl)c(C(=O)O)c(Cl)c1)c1cccc(O)c1 |
| InChI | InChI=1S/C16H15Cl2O4P/c1-23(22,12-4-2-3-11(19)9-12)6-5-10-7-13(17)15(16(20)21)14(18)8-10/h2-4,7-9,22H,5-6H2,1H3,(H-,19,20,21)/p+1 |
| InChIKey | DNONGMGXGPGYIJ-UHFFFAOYSA-O |
| XLogP | 3.82 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.18 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|