C26H24O6 — CID 5183155
[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(2-methoxyphenyl)-2-phenylprop-2-enoate (PubChem CID 5183155) has the molecular formula C26H24O6 and a molecular weight of 432.47 g/mol. Its IUPAC name is [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(2-methoxyphenyl)-2-phenylprop-2-enoate.
| Compound Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(2-methoxyphenyl)-2-phenylprop-2-enoate |
|---|---|
| PubChem CID | 5183155 |
| Molecular Formula | C26H24O6 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(2-methoxyphenyl)-2-phenylprop-2-enoate |
| SMILES | COc1ccc(C(=O)COC(=O)C(=Cc2ccccc2OC)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C26H24O6/c1-29-20-13-14-21(25(16-20)31-3)23(27)17-32-26(28)22(18-9-5-4-6-10-18)15-19-11-7-8-12-24(19)30-2/h4-16H,17H2,1-3H3 |
| InChIKey | GRTIWORNNCJBNG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|