C18H18O5 — CID 2604638
[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-methylbenzoate (PubChem CID 2604638) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-methylbenzoate.
| Compound Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 2604638 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 2-methylbenzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccccc2C)c(OC)c1 |
| InChI | InChI=1S/C18H18O5/c1-12-6-4-5-7-14(12)18(20)23-11-16(19)15-9-8-13(21-2)10-17(15)22-3/h4-10H,11H2,1-3H3 |
| InChIKey | LPPHCVOXNIYWFP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |